C12H14N2O2S — CID 116999798
2-[(2-amino-1,3-benzothiazol-6-yl)methyl]butanoic acid (PubChem CID 116999798) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-[(2-amino-1,3-benzothiazol-6-yl)methyl]butanoic acid.
| Compound Name | 2-[(2-amino-1,3-benzothiazol-6-yl)methyl]butanoic acid |
|---|---|
| PubChem CID | 116999798 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 2-[(2-amino-1,3-benzothiazol-6-yl)methyl]butanoic acid |
| SMILES | CCC(Cc1ccc2nc(N)sc2c1)C(=O)O |
| InChI | InChI=1S/C12H14N2O2S/c1-2-8(11(15)16)5-7-3-4-9-10(6-7)17-12(13)14-9/h3-4,6,8H,2,5H2,1H3,(H2,13,14)(H,15,16) |
| InChIKey | OQQNBVVQWMWNRR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |