C9H10N4S2 — CID 169358383
(2-amino-6-methyl-1,3-benzothiazol-5-yl)thiourea (PubChem CID 169358383) has the molecular formula C9H10N4S2 and a molecular weight of 238.34 g/mol. Its IUPAC name is (2-amino-6-methyl-1,3-benzothiazol-5-yl)thiourea.
| Compound Name | (2-amino-6-methyl-1,3-benzothiazol-5-yl)thiourea |
|---|---|
| PubChem CID | 169358383 |
| Molecular Formula | C9H10N4S2 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | (2-amino-6-methyl-1,3-benzothiazol-5-yl)thiourea |
| SMILES | Cc1cc2sc(N)nc2cc1NC(N)=S |
| InChI | InChI=1S/C9H10N4S2/c1-4-2-7-6(13-9(11)15-7)3-5(4)12-8(10)14/h2-3H,1H3,(H2,11,13)(H3,10,12,14) |
| InChIKey | PBOFPESUAFOAHJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|