C11H6Cl3NO2 — CID 102614359
methyl 4,5,8-trichloroquinoline-3-carboxylate (PubChem CID 102614359) has the molecular formula C11H6Cl3NO2 and a molecular weight of 290.53 g/mol. Its IUPAC name is methyl 4,5,8-trichloroquinoline-3-carboxylate.
| Compound Name | methyl 4,5,8-trichloroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 102614359 |
| Molecular Formula | C11H6Cl3NO2 |
| Molecular Weight | 290.53 g/mol |
| Exact Mass | 288.95 |
| IUPAC Name | methyl 4,5,8-trichloroquinoline-3-carboxylate |
| SMILES | COC(=O)c1cnc2c(Cl)ccc(Cl)c2c1Cl |
| InChI | InChI=1S/C11H6Cl3NO2/c1-17-11(16)5-4-15-10-7(13)3-2-6(12)8(10)9(5)14/h2-4H,1H3 |
| InChIKey | CQOZLJKFMOKFBQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |