C13H11Cl2NO4 — CID 102614449
methyl 4,6-dichloro-5,8-dimethoxyquinoline-3-carboxylate (PubChem CID 102614449) has the molecular formula C13H11Cl2NO4 and a molecular weight of 316.14 g/mol. Its IUPAC name is methyl 4,6-dichloro-5,8-dimethoxyquinoline-3-carboxylate.
| Compound Name | methyl 4,6-dichloro-5,8-dimethoxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 102614449 |
| Molecular Formula | C13H11Cl2NO4 |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | methyl 4,6-dichloro-5,8-dimethoxyquinoline-3-carboxylate |
| SMILES | COC(=O)c1cnc2c(OC)cc(Cl)c(OC)c2c1Cl |
| InChI | InChI=1S/C13H11Cl2NO4/c1-18-8-4-7(14)12(19-2)9-10(15)6(13(17)20-3)5-16-11(8)9/h4-5H,1-3H3 |
| InChIKey | RZBMACBFTCISBX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |