methyl 4-[(2-amino-1,3-thiazol-5-yl)oxy]-2-chlorobenzoate

C11H9ClN2O3S — CID 88861650

IUPACmethyl 4-[(2-amino-1,3-thiazol-5-yl)oxy]-2-chlorobenzoate
SMILESCOC(=O)c1ccc(Oc2cnc(N)s2)cc1Cl
InChIInChI=1S/C11H9ClN2O3S/c1-16-10(15)7-3-2-6(4-8(7)12)17-9-5-14-11(13)18-9/h2-5H,1H3,(H2,13,14)
InChIKeyJSNZQGILYLTSMQ-UHFFFAOYSA-N
MW284.72 g/mol
LogP2.96
Rot. Bonds3

About methyl 4-[(2-amino-1,3-thiazol-5-yl)oxy]-2-chlorobenzoate

methyl 4-[(2-amino-1,3-thiazol-5-yl)oxy]-2-chlorobenzoate (PubChem CID 88861650) has the molecular formula C11H9ClN2O3S and a molecular weight of 284.72 g/mol. Its IUPAC name is methyl 4-[(2-amino-1,3-thiazol-5-yl)oxy]-2-chlorobenzoate.

Molecular Properties

Compound Namemethyl 4-[(2-amino-1,3-thiazol-5-yl)oxy]-2-chlorobenzoate
PubChem CID88861650
Molecular FormulaC11H9ClN2O3S
Molecular Weight284.72 g/mol
Exact Mass284.00
IUPAC Namemethyl 4-[(2-amino-1,3-thiazol-5-yl)oxy]-2-chlorobenzoate
SMILESCOC(=O)c1ccc(Oc2cnc(N)s2)cc1Cl
InChIInChI=1S/C11H9ClN2O3S/c1-16-10(15)7-3-2-6(4-8(7)12)17-9-5-14-11(13)18-9/h2-5H,1H3,(H2,13,14)
InChIKeyJSNZQGILYLTSMQ-UHFFFAOYSA-N
XLogP2.96
TPSA74.44 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.72
LogP ≤ 52.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 4-[(2-amino-1,3-thiazol-5-yl)oxy]-2-chlorobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[(2-amino-1,3-thiazol-5-yl)oxy]-2-chlorobenzoate?
The IUPAC name of methyl 4-[(2-amino-1,3-thiazol-5-yl)oxy]-2-chlorobenzoate (CID 88861650) is methyl 4-[(2-amino-1,3-thiazol-5-yl)oxy]-2-chlorobenzoate.
What is the SMILES notation for methyl 4-[(2-amino-1,3-thiazol-5-yl)oxy]-2-chlorobenzoate?
The canonical SMILES for methyl 4-[(2-amino-1,3-thiazol-5-yl)oxy]-2-chlorobenzoate is COC(=O)c1ccc(Oc2cnc(N)s2)cc1Cl.
What is the InChIKey of methyl 4-[(2-amino-1,3-thiazol-5-yl)oxy]-2-chlorobenzoate?
The InChIKey is JSNZQGILYLTSMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN2O3S/c1-16-10(15)7-3-2-6(4-8(7)12)17-9-5-14-11(13)18-9/h2-5H,1H3,(H2,13,14).
What are the key properties of methyl 4-[(2-amino-1,3-thiazol-5-yl)oxy]-2-chlorobenzoate?
methyl 4-[(2-amino-1,3-thiazol-5-yl)oxy]-2-chlorobenzoate has a molecular weight of 284.72 g/mol, XLogP of 2.96, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2-amino-1,3-thiazol-5-yl)oxy]-2-chlorobenzoate is sourced from PubChem (CID 88861650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).