C11H9ClN2O3S — CID 88861650
methyl 4-[(2-amino-1,3-thiazol-5-yl)oxy]-2-chlorobenzoate (PubChem CID 88861650) has the molecular formula C11H9ClN2O3S and a molecular weight of 284.72 g/mol. Its IUPAC name is methyl 4-[(2-amino-1,3-thiazol-5-yl)oxy]-2-chlorobenzoate.
| Compound Name | methyl 4-[(2-amino-1,3-thiazol-5-yl)oxy]-2-chlorobenzoate |
|---|---|
| PubChem CID | 88861650 |
| Molecular Formula | C11H9ClN2O3S |
| Molecular Weight | 284.72 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | methyl 4-[(2-amino-1,3-thiazol-5-yl)oxy]-2-chlorobenzoate |
| SMILES | COC(=O)c1ccc(Oc2cnc(N)s2)cc1Cl |
| InChI | InChI=1S/C11H9ClN2O3S/c1-16-10(15)7-3-2-6(4-8(7)12)17-9-5-14-11(13)18-9/h2-5H,1H3,(H2,13,14) |
| InChIKey | JSNZQGILYLTSMQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.72 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |