About methyl 2-chloro-4-fluorobenzoate;methyl 2-chloro-4-phenoxybenzoate;phenol
methyl 2-chloro-4-fluorobenzoate;methyl 2-chloro-4-phenoxybenzoate;phenol (PubChem CID 157480353) has the molecular formula C28H23Cl2FO6
and a molecular weight of 545.39 g/mol. Its IUPAC name is methyl 2-chloro-4-fluorobenzoate;methyl 2-chloro-4-phenoxybenzoate;phenol.
Molecular Properties
| Compound Name | methyl 2-chloro-4-fluorobenzoate;methyl 2-chloro-4-phenoxybenzoate;phenol |
| PubChem CID | 157480353 |
| Molecular Formula | C28H23Cl2FO6 |
| Molecular Weight | 545.39 g/mol |
| Exact Mass | 544.09 |
| IUPAC Name | methyl 2-chloro-4-fluorobenzoate;methyl 2-chloro-4-phenoxybenzoate;phenol |
| SMILES | COC(=O)c1ccc(F)cc1Cl.COC(=O)c1ccc(Oc2ccccc2)cc1Cl.Oc1ccccc1 |
| InChI | InChI=1S/C14H11ClO3.C8H6ClFO2.C6H6O/c1-17-14(16)12-8-7-11(9-13(12)15)18-10-5-3-2-4-6-10;1-12-8(11)6-3-2-5(10)4-7(6)9;7-6-4-2-1-3-5-6/h2-9H,1H3;2-4H,1H3;1-5,7H |
| InChIKey | BWBZKVTVRUECCP-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 545.39 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-chloro-4-fluorobenzoate;methyl 2-chloro-4-phenoxybenzoate;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-chloro-4-fluorobenzoate;methyl 2-chloro-4-phenoxybenzoate;phenol?
The IUPAC name of methyl 2-chloro-4-fluorobenzoate;methyl 2-chloro-4-phenoxybenzoate;phenol (CID 157480353) is methyl 2-chloro-4-fluorobenzoate;methyl 2-chloro-4-phenoxybenzoate;phenol.
What is the SMILES notation for methyl 2-chloro-4-fluorobenzoate;methyl 2-chloro-4-phenoxybenzoate;phenol?
The canonical SMILES for methyl 2-chloro-4-fluorobenzoate;methyl 2-chloro-4-phenoxybenzoate;phenol is COC(=O)c1ccc(F)cc1Cl.COC(=O)c1ccc(Oc2ccccc2)cc1Cl.Oc1ccccc1.
What is the InChIKey of methyl 2-chloro-4-fluorobenzoate;methyl 2-chloro-4-phenoxybenzoate;phenol?
The InChIKey is BWBZKVTVRUECCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClO3.C8H6ClFO2.C6H6O/c1-17-14(16)12-8-7-11(9-13(12)15)18-10-5-3-2-4-6-10;1-12-8(11)6-3-2-5(10)4-7(6)9;7-6-4-2-1-3-5-6/h2-9H,1H3;2-4H,1H3;1-5,7H.
What are the key properties of methyl 2-chloro-4-fluorobenzoate;methyl 2-chloro-4-phenoxybenzoate;phenol?
methyl 2-chloro-4-fluorobenzoate;methyl 2-chloro-4-phenoxybenzoate;phenol has a molecular weight of 545.39 g/mol, XLogP of 7.58, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-chloro-4-fluorobenzoate;methyl 2-chloro-4-phenoxybenzoate;phenol is sourced from PubChem (CID 157480353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).