5-chloro-2-methoxycarbonyl-1,3-thiazole-4-carboxylic acid

C6H4ClNO4S — CID 84788297

IUPAC5-chloro-2-methoxycarbonyl-1,3-thiazole-4-carboxylic acid
SMILESCOC(=O)c1nc(C(=O)O)c(Cl)s1
InChIInChI=1S/C6H4ClNO4S/c1-12-6(11)4-8-2(5(9)10)3(7)13-4/h1H3,(H,9,10)
InChIKeyJQRAZILCUKUFJE-UHFFFAOYSA-N
MW221.62 g/mol
LogP1.28
Rot. Bonds2

About 5-chloro-2-methoxycarbonyl-1,3-thiazole-4-carboxylic acid

5-chloro-2-methoxycarbonyl-1,3-thiazole-4-carboxylic acid (PubChem CID 84788297) has the molecular formula C6H4ClNO4S and a molecular weight of 221.62 g/mol. Its IUPAC name is 5-chloro-2-methoxycarbonyl-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name5-chloro-2-methoxycarbonyl-1,3-thiazole-4-carboxylic acid
PubChem CID84788297
Molecular FormulaC6H4ClNO4S
Molecular Weight221.62 g/mol
Exact Mass220.95
IUPAC Name5-chloro-2-methoxycarbonyl-1,3-thiazole-4-carboxylic acid
SMILESCOC(=O)c1nc(C(=O)O)c(Cl)s1
InChIInChI=1S/C6H4ClNO4S/c1-12-6(11)4-8-2(5(9)10)3(7)13-4/h1H3,(H,9,10)
InChIKeyJQRAZILCUKUFJE-UHFFFAOYSA-N
XLogP1.28
TPSA76.49 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.62
LogP ≤ 51.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 5-chloro-2-methoxycarbonyl-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chloro-2-methoxycarbonyl-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-chloro-2-methoxycarbonyl-1,3-thiazole-4-carboxylic acid (CID 84788297) is 5-chloro-2-methoxycarbonyl-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-chloro-2-methoxycarbonyl-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-chloro-2-methoxycarbonyl-1,3-thiazole-4-carboxylic acid is COC(=O)c1nc(C(=O)O)c(Cl)s1.
What is the InChIKey of 5-chloro-2-methoxycarbonyl-1,3-thiazole-4-carboxylic acid?
The InChIKey is JQRAZILCUKUFJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClNO4S/c1-12-6(11)4-8-2(5(9)10)3(7)13-4/h1H3,(H,9,10).
What are the key properties of 5-chloro-2-methoxycarbonyl-1,3-thiazole-4-carboxylic acid?
5-chloro-2-methoxycarbonyl-1,3-thiazole-4-carboxylic acid has a molecular weight of 221.62 g/mol, XLogP of 1.28, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-methoxycarbonyl-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 84788297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).