About 5-(5-fluoro-[1,3]thiazolo[4,5-b]pyridin-2-yl)-N-methylpyridin-2-amine
5-(5-fluoro-[1,3]thiazolo[4,5-b]pyridin-2-yl)-N-methylpyridin-2-amine (PubChem CID 70846385) has the molecular formula C12H9FN4S
and a molecular weight of 260.30 g/mol. Its IUPAC name is 5-(5-fluoro-[1,3]thiazolo[4,5-b]pyridin-2-yl)-N-methylpyridin-2-amine.
Molecular Properties
| Compound Name | 5-(5-fluoro-[1,3]thiazolo[4,5-b]pyridin-2-yl)-N-methylpyridin-2-amine |
| PubChem CID | 70846385 |
| Molecular Formula | C12H9FN4S |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 5-(5-fluoro-[1,3]thiazolo[4,5-b]pyridin-2-yl)-N-methylpyridin-2-amine |
| SMILES | CNc1ccc(-c2nc3nc(F)ccc3s2)cn1 |
| InChI | InChI=1S/C12H9FN4S/c1-14-10-5-2-7(6-15-10)12-17-11-8(18-12)3-4-9(13)16-11/h2-6H,1H3,(H,14,15) |
| InChIKey | KOMJKSSFLCFJFF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-(5-fluoro-[1,3]thiazolo[4,5-b]pyridin-2-yl)-N-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-fluoro-[1,3]thiazolo[4,5-b]pyridin-2-yl)-N-methylpyridin-2-amine?
The IUPAC name of 5-(5-fluoro-[1,3]thiazolo[4,5-b]pyridin-2-yl)-N-methylpyridin-2-amine (CID 70846385) is 5-(5-fluoro-[1,3]thiazolo[4,5-b]pyridin-2-yl)-N-methylpyridin-2-amine.
What is the SMILES notation for 5-(5-fluoro-[1,3]thiazolo[4,5-b]pyridin-2-yl)-N-methylpyridin-2-amine?
The canonical SMILES for 5-(5-fluoro-[1,3]thiazolo[4,5-b]pyridin-2-yl)-N-methylpyridin-2-amine is CNc1ccc(-c2nc3nc(F)ccc3s2)cn1.
What is the InChIKey of 5-(5-fluoro-[1,3]thiazolo[4,5-b]pyridin-2-yl)-N-methylpyridin-2-amine?
The InChIKey is KOMJKSSFLCFJFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9FN4S/c1-14-10-5-2-7(6-15-10)12-17-11-8(18-12)3-4-9(13)16-11/h2-6H,1H3,(H,14,15).
What are the key properties of 5-(5-fluoro-[1,3]thiazolo[4,5-b]pyridin-2-yl)-N-methylpyridin-2-amine?
5-(5-fluoro-[1,3]thiazolo[4,5-b]pyridin-2-yl)-N-methylpyridin-2-amine has a molecular weight of 260.30 g/mol, XLogP of 2.93, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-fluoro-[1,3]thiazolo[4,5-b]pyridin-2-yl)-N-methylpyridin-2-amine is sourced from PubChem (CID 70846385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).