methyl 2-cyclopropyl-[1,3]thiazolo[4,5-b]pyridine-5-carboxylate

C11H10N2O2S — CID 118644349

IUPACmethyl 2-cyclopropyl-[1,3]thiazolo[4,5-b]pyridine-5-carboxylate
SMILESCOC(=O)c1ccc2sc(C3CC3)nc2n1
InChIInChI=1S/C11H10N2O2S/c1-15-11(14)7-4-5-8-9(12-7)13-10(16-8)6-2-3-6/h4-6H,2-3H2,1H3
InChIKeyWQKADOSPIVRPCM-UHFFFAOYSA-N
MW234.28 g/mol
LogP2.36
Rot. Bonds2

About methyl 2-cyclopropyl-[1,3]thiazolo[4,5-b]pyridine-5-carboxylate

methyl 2-cyclopropyl-[1,3]thiazolo[4,5-b]pyridine-5-carboxylate (PubChem CID 118644349) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is methyl 2-cyclopropyl-[1,3]thiazolo[4,5-b]pyridine-5-carboxylate.

Molecular Properties

Compound Namemethyl 2-cyclopropyl-[1,3]thiazolo[4,5-b]pyridine-5-carboxylate
PubChem CID118644349
Molecular FormulaC11H10N2O2S
Molecular Weight234.28 g/mol
Exact Mass234.05
IUPAC Namemethyl 2-cyclopropyl-[1,3]thiazolo[4,5-b]pyridine-5-carboxylate
SMILESCOC(=O)c1ccc2sc(C3CC3)nc2n1
InChIInChI=1S/C11H10N2O2S/c1-15-11(14)7-4-5-8-9(12-7)13-10(16-8)6-2-3-6/h4-6H,2-3H2,1H3
InChIKeyWQKADOSPIVRPCM-UHFFFAOYSA-N
XLogP2.36
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.28
LogP ≤ 52.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-cyclopropyl-[1,3]thiazolo[4,5-b]pyridine-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-cyclopropyl-[1,3]thiazolo[4,5-b]pyridine-5-carboxylate?
The IUPAC name of methyl 2-cyclopropyl-[1,3]thiazolo[4,5-b]pyridine-5-carboxylate (CID 118644349) is methyl 2-cyclopropyl-[1,3]thiazolo[4,5-b]pyridine-5-carboxylate.
What is the SMILES notation for methyl 2-cyclopropyl-[1,3]thiazolo[4,5-b]pyridine-5-carboxylate?
The canonical SMILES for methyl 2-cyclopropyl-[1,3]thiazolo[4,5-b]pyridine-5-carboxylate is COC(=O)c1ccc2sc(C3CC3)nc2n1.
What is the InChIKey of methyl 2-cyclopropyl-[1,3]thiazolo[4,5-b]pyridine-5-carboxylate?
The InChIKey is WQKADOSPIVRPCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2S/c1-15-11(14)7-4-5-8-9(12-7)13-10(16-8)6-2-3-6/h4-6H,2-3H2,1H3.
What are the key properties of methyl 2-cyclopropyl-[1,3]thiazolo[4,5-b]pyridine-5-carboxylate?
methyl 2-cyclopropyl-[1,3]thiazolo[4,5-b]pyridine-5-carboxylate has a molecular weight of 234.28 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-cyclopropyl-[1,3]thiazolo[4,5-b]pyridine-5-carboxylate is sourced from PubChem (CID 118644349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).