C10H6F2O2S — CID 165347141
methyl 5,6-difluoro-1-benzothiophene-2-carboxylate (PubChem CID 165347141) has the molecular formula C10H6F2O2S and a molecular weight of 228.22 g/mol. Its IUPAC name is methyl 5,6-difluoro-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 5,6-difluoro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 165347141 |
| Molecular Formula | C10H6F2O2S |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | methyl 5,6-difluoro-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1cc2cc(F)c(F)cc2s1 |
| InChI | InChI=1S/C10H6F2O2S/c1-14-10(13)9-3-5-2-6(11)7(12)4-8(5)15-9/h2-4H,1H3 |
| InChIKey | MJUUDLUEIYKHAD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |