methyl 5,6-difluoro-1-benzothiophene-2-carboxylate

C10H6F2O2S — CID 165347141

IUPACmethyl 5,6-difluoro-1-benzothiophene-2-carboxylate
SMILESCOC(=O)c1cc2cc(F)c(F)cc2s1
InChIInChI=1S/C10H6F2O2S/c1-14-10(13)9-3-5-2-6(11)7(12)4-8(5)15-9/h2-4H,1H3
InChIKeyMJUUDLUEIYKHAD-UHFFFAOYSA-N
MW228.22 g/mol
LogP2.97
Rot. Bonds1

About methyl 5,6-difluoro-1-benzothiophene-2-carboxylate

methyl 5,6-difluoro-1-benzothiophene-2-carboxylate (PubChem CID 165347141) has the molecular formula C10H6F2O2S and a molecular weight of 228.22 g/mol. Its IUPAC name is methyl 5,6-difluoro-1-benzothiophene-2-carboxylate.

Molecular Properties

Compound Namemethyl 5,6-difluoro-1-benzothiophene-2-carboxylate
PubChem CID165347141
Molecular FormulaC10H6F2O2S
Molecular Weight228.22 g/mol
Exact Mass228.01
IUPAC Namemethyl 5,6-difluoro-1-benzothiophene-2-carboxylate
SMILESCOC(=O)c1cc2cc(F)c(F)cc2s1
InChIInChI=1S/C10H6F2O2S/c1-14-10(13)9-3-5-2-6(11)7(12)4-8(5)15-9/h2-4H,1H3
InChIKeyMJUUDLUEIYKHAD-UHFFFAOYSA-N
XLogP2.97
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.22
LogP ≤ 52.97
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 5,6-difluoro-1-benzothiophene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5,6-difluoro-1-benzothiophene-2-carboxylate?
The IUPAC name of methyl 5,6-difluoro-1-benzothiophene-2-carboxylate (CID 165347141) is methyl 5,6-difluoro-1-benzothiophene-2-carboxylate.
What is the SMILES notation for methyl 5,6-difluoro-1-benzothiophene-2-carboxylate?
The canonical SMILES for methyl 5,6-difluoro-1-benzothiophene-2-carboxylate is COC(=O)c1cc2cc(F)c(F)cc2s1.
What is the InChIKey of methyl 5,6-difluoro-1-benzothiophene-2-carboxylate?
The InChIKey is MJUUDLUEIYKHAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F2O2S/c1-14-10(13)9-3-5-2-6(11)7(12)4-8(5)15-9/h2-4H,1H3.
What are the key properties of methyl 5,6-difluoro-1-benzothiophene-2-carboxylate?
methyl 5,6-difluoro-1-benzothiophene-2-carboxylate has a molecular weight of 228.22 g/mol, XLogP of 2.97, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5,6-difluoro-1-benzothiophene-2-carboxylate is sourced from PubChem (CID 165347141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).