C11H8BrF2O5PS — CID 118344677
[(5-bromo-2-methoxycarbonyl-1-benzothiophen-6-yl)-difluoromethyl]phosphonic acid (PubChem CID 118344677) has the molecular formula C11H8BrF2O5PS and a molecular weight of 401.12 g/mol. Its IUPAC name is [(5-bromo-2-methoxycarbonyl-1-benzothiophen-6-yl)-difluoromethyl]phosphonic acid.
| Compound Name | [(5-bromo-2-methoxycarbonyl-1-benzothiophen-6-yl)-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 118344677 |
| Molecular Formula | C11H8BrF2O5PS |
| Molecular Weight | 401.12 g/mol |
| Exact Mass | 399.90 |
| IUPAC Name | [(5-bromo-2-methoxycarbonyl-1-benzothiophen-6-yl)-difluoromethyl]phosphonic acid |
| SMILES | COC(=O)c1cc2cc(Br)c(C(F)(F)P(=O)(O)O)cc2s1 |
| InChI | InChI=1S/C11H8BrF2O5PS/c1-19-10(15)9-3-5-2-7(12)6(4-8(5)21-9)11(13,14)20(16,17)18/h2-4H,1H3,(H2,16,17,18) |
| InChIKey | NIFCOLADCGONKJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.12 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|