C10H6BrF2INO3PS — CID 170423732
[(6-bromo-2-carbamoyl-1-benzothiophen-5-yl)-difluoromethyl]-iodophosphinic acid (PubChem CID 170423732) has the molecular formula C10H6BrF2INO3PS and a molecular weight of 496.01 g/mol. Its IUPAC name is [(6-bromo-2-carbamoyl-1-benzothiophen-5-yl)-difluoromethyl]-iodophosphinic acid.
| Compound Name | [(6-bromo-2-carbamoyl-1-benzothiophen-5-yl)-difluoromethyl]-iodophosphinic acid |
|---|---|
| PubChem CID | 170423732 |
| Molecular Formula | C10H6BrF2INO3PS |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 494.80 |
| IUPAC Name | [(6-bromo-2-carbamoyl-1-benzothiophen-5-yl)-difluoromethyl]-iodophosphinic acid |
| SMILES | NC(=O)c1cc2cc(C(F)(F)P(=O)(O)I)c(Br)cc2s1 |
| InChI | InChI=1S/C10H6BrF2INO3PS/c11-6-3-7-4(2-8(20-7)9(15)16)1-5(6)10(12,13)19(14,17)18/h1-3H,(H2,15,16)(H,17,18) |
| InChIKey | OWKKPCIANCHLMB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|