About hydron;thieno[2,3-b]pyridine-2-carboxamide
hydron;thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 174476240) has the molecular formula C8H7N2OS+
and a molecular weight of 179.22 g/mol. Its IUPAC name is hydron;thieno[2,3-b]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | hydron;thieno[2,3-b]pyridine-2-carboxamide |
| PubChem CID | 174476240 |
| Molecular Formula | C8H7N2OS+ |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | hydron;thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc2cccnc2s1.[H+] |
| InChI | InChI=1S/C8H6N2OS/c9-7(11)6-4-5-2-1-3-10-8(5)12-6/h1-4H,(H2,9,11)/p+1 |
| InChIKey | RXGHULSMJIVVTA-UHFFFAOYSA-O |
| XLogP | 1.51 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze hydron;thieno[2,3-b]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;thieno[2,3-b]pyridine-2-carboxamide?
The IUPAC name of hydron;thieno[2,3-b]pyridine-2-carboxamide (CID 174476240) is hydron;thieno[2,3-b]pyridine-2-carboxamide.
What is the SMILES notation for hydron;thieno[2,3-b]pyridine-2-carboxamide?
The canonical SMILES for hydron;thieno[2,3-b]pyridine-2-carboxamide is NC(=O)c1cc2cccnc2s1.[H+].
What is the InChIKey of hydron;thieno[2,3-b]pyridine-2-carboxamide?
The InChIKey is RXGHULSMJIVVTA-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H6N2OS/c9-7(11)6-4-5-2-1-3-10-8(5)12-6/h1-4H,(H2,9,11)/p+1.
What are the key properties of hydron;thieno[2,3-b]pyridine-2-carboxamide?
hydron;thieno[2,3-b]pyridine-2-carboxamide has a molecular weight of 179.22 g/mol, XLogP of 1.51, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;thieno[2,3-b]pyridine-2-carboxamide is sourced from PubChem (CID 174476240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).