C8H7N2OS+ — CID 174476240
hydron;thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 174476240) has the molecular formula C8H7N2OS+ and a molecular weight of 179.22 g/mol. Its IUPAC name is hydron;thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | hydron;thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 174476240 |
| Molecular Formula | C8H7N2OS+ |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | hydron;thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc2cccnc2s1.[H+] |
| InChI | InChI=1S/C8H6N2OS/c9-7(11)6-4-5-2-1-3-10-8(5)12-6/h1-4H,(H2,9,11)/p+1 |
| InChIKey | RXGHULSMJIVVTA-UHFFFAOYSA-O |
| XLogP | 1.51 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |