thieno[2,3-b]pyridin-2-ylcarbamic acid

C8H6N2O2S — CID 142702940

IUPACthieno[2,3-b]pyridin-2-ylcarbamic acid
SMILESO=C(O)Nc1cc2cccnc2s1
InChIInChI=1S/C8H6N2O2S/c11-8(12)10-6-4-5-2-1-3-9-7(5)13-6/h1-4,10H,(H,11,12)
InChIKeyRVTGPTIHQZFLRC-UHFFFAOYSA-N
MW194.22 g/mol
LogP2.39
Rot. Bonds1

About thieno[2,3-b]pyridin-2-ylcarbamic acid

thieno[2,3-b]pyridin-2-ylcarbamic acid (PubChem CID 142702940) has the molecular formula C8H6N2O2S and a molecular weight of 194.22 g/mol. Its IUPAC name is thieno[2,3-b]pyridin-2-ylcarbamic acid.

Molecular Properties

Compound Namethieno[2,3-b]pyridin-2-ylcarbamic acid
PubChem CID142702940
Molecular FormulaC8H6N2O2S
Molecular Weight194.22 g/mol
Exact Mass194.01
IUPAC Namethieno[2,3-b]pyridin-2-ylcarbamic acid
SMILESO=C(O)Nc1cc2cccnc2s1
InChIInChI=1S/C8H6N2O2S/c11-8(12)10-6-4-5-2-1-3-9-7(5)13-6/h1-4,10H,(H,11,12)
InChIKeyRVTGPTIHQZFLRC-UHFFFAOYSA-N
XLogP2.39
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.22
LogP ≤ 52.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze thieno[2,3-b]pyridin-2-ylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of thieno[2,3-b]pyridin-2-ylcarbamic acid?
The IUPAC name of thieno[2,3-b]pyridin-2-ylcarbamic acid (CID 142702940) is thieno[2,3-b]pyridin-2-ylcarbamic acid.
What is the SMILES notation for thieno[2,3-b]pyridin-2-ylcarbamic acid?
The canonical SMILES for thieno[2,3-b]pyridin-2-ylcarbamic acid is O=C(O)Nc1cc2cccnc2s1.
What is the InChIKey of thieno[2,3-b]pyridin-2-ylcarbamic acid?
The InChIKey is RVTGPTIHQZFLRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2S/c11-8(12)10-6-4-5-2-1-3-9-7(5)13-6/h1-4,10H,(H,11,12).
What are the key properties of thieno[2,3-b]pyridin-2-ylcarbamic acid?
thieno[2,3-b]pyridin-2-ylcarbamic acid has a molecular weight of 194.22 g/mol, XLogP of 2.39, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[2,3-b]pyridin-2-ylcarbamic acid is sourced from PubChem (CID 142702940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).