C8H6N2O2S — CID 142702940
thieno[2,3-b]pyridin-2-ylcarbamic acid (PubChem CID 142702940) has the molecular formula C8H6N2O2S and a molecular weight of 194.22 g/mol. Its IUPAC name is thieno[2,3-b]pyridin-2-ylcarbamic acid.
| Compound Name | thieno[2,3-b]pyridin-2-ylcarbamic acid |
|---|---|
| PubChem CID | 142702940 |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | thieno[2,3-b]pyridin-2-ylcarbamic acid |
| SMILES | O=C(O)Nc1cc2cccnc2s1 |
| InChI | InChI=1S/C8H6N2O2S/c11-8(12)10-6-4-5-2-1-3-9-7(5)13-6/h1-4,10H,(H,11,12) |
| InChIKey | RVTGPTIHQZFLRC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |