About thieno[2,3-b]pyridin-2-yl benzoate
thieno[2,3-b]pyridin-2-yl benzoate (PubChem CID 167343123) has the molecular formula C14H9NO2S
and a molecular weight of 255.30 g/mol. Its IUPAC name is thieno[2,3-b]pyridin-2-yl benzoate.
Molecular Properties
| Compound Name | thieno[2,3-b]pyridin-2-yl benzoate |
| PubChem CID | 167343123 |
| Molecular Formula | C14H9NO2S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | thieno[2,3-b]pyridin-2-yl benzoate |
| SMILES | O=C(Oc1cc2cccnc2s1)c1ccccc1 |
| InChI | InChI=1S/C14H9NO2S/c16-14(10-5-2-1-3-6-10)17-12-9-11-7-4-8-15-13(11)18-12/h1-9H |
| InChIKey | QZMLAXCHRVRCEM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze thieno[2,3-b]pyridin-2-yl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[2,3-b]pyridin-2-yl benzoate?
The IUPAC name of thieno[2,3-b]pyridin-2-yl benzoate (CID 167343123) is thieno[2,3-b]pyridin-2-yl benzoate.
What is the SMILES notation for thieno[2,3-b]pyridin-2-yl benzoate?
The canonical SMILES for thieno[2,3-b]pyridin-2-yl benzoate is O=C(Oc1cc2cccnc2s1)c1ccccc1.
What is the InChIKey of thieno[2,3-b]pyridin-2-yl benzoate?
The InChIKey is QZMLAXCHRVRCEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO2S/c16-14(10-5-2-1-3-6-10)17-12-9-11-7-4-8-15-13(11)18-12/h1-9H.
What are the key properties of thieno[2,3-b]pyridin-2-yl benzoate?
thieno[2,3-b]pyridin-2-yl benzoate has a molecular weight of 255.30 g/mol, XLogP of 3.52, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[2,3-b]pyridin-2-yl benzoate is sourced from PubChem (CID 167343123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).