About (2-chloro-1,3-thiazol-5-yl) benzoate
(2-chloro-1,3-thiazol-5-yl) benzoate (PubChem CID 174619966) has the molecular formula C10H6ClNO2S
and a molecular weight of 239.68 g/mol. Its IUPAC name is (2-chloro-1,3-thiazol-5-yl) benzoate.
Molecular Properties
| Compound Name | (2-chloro-1,3-thiazol-5-yl) benzoate |
| PubChem CID | 174619966 |
| Molecular Formula | C10H6ClNO2S |
| Molecular Weight | 239.68 g/mol |
| Exact Mass | 238.98 |
| IUPAC Name | (2-chloro-1,3-thiazol-5-yl) benzoate |
| SMILES | O=C(Oc1cnc(Cl)s1)c1ccccc1 |
| InChI | InChI=1S/C10H6ClNO2S/c11-10-12-6-8(15-10)14-9(13)7-4-2-1-3-5-7/h1-6H |
| InChIKey | GDRDGIPCEGGJRN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.68 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-chloro-1,3-thiazol-5-yl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-1,3-thiazol-5-yl) benzoate?
The IUPAC name of (2-chloro-1,3-thiazol-5-yl) benzoate (CID 174619966) is (2-chloro-1,3-thiazol-5-yl) benzoate.
What is the SMILES notation for (2-chloro-1,3-thiazol-5-yl) benzoate?
The canonical SMILES for (2-chloro-1,3-thiazol-5-yl) benzoate is O=C(Oc1cnc(Cl)s1)c1ccccc1.
What is the InChIKey of (2-chloro-1,3-thiazol-5-yl) benzoate?
The InChIKey is GDRDGIPCEGGJRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6ClNO2S/c11-10-12-6-8(15-10)14-9(13)7-4-2-1-3-5-7/h1-6H.
What are the key properties of (2-chloro-1,3-thiazol-5-yl) benzoate?
(2-chloro-1,3-thiazol-5-yl) benzoate has a molecular weight of 239.68 g/mol, XLogP of 3.02, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-1,3-thiazol-5-yl) benzoate is sourced from PubChem (CID 174619966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).