C10H4BrClF2OS — CID 171366120
1-(5-bromo-1-benzothiophen-2-yl)-2-chloro-2,2-difluoroethanone (PubChem CID 171366120) has the molecular formula C10H4BrClF2OS and a molecular weight of 325.56 g/mol. Its IUPAC name is 1-(5-bromo-1-benzothiophen-2-yl)-2-chloro-2,2-difluoroethanone.
| Compound Name | 1-(5-bromo-1-benzothiophen-2-yl)-2-chloro-2,2-difluoroethanone |
|---|---|
| PubChem CID | 171366120 |
| Molecular Formula | C10H4BrClF2OS |
| Molecular Weight | 325.56 g/mol |
| Exact Mass | 323.88 |
| IUPAC Name | 1-(5-bromo-1-benzothiophen-2-yl)-2-chloro-2,2-difluoroethanone |
| SMILES | O=C(c1cc2cc(Br)ccc2s1)C(F)(F)Cl |
| InChI | InChI=1S/C10H4BrClF2OS/c11-6-1-2-7-5(3-6)4-8(16-7)9(15)10(12,13)14/h1-4H |
| InChIKey | BPKSZKVTUMEBDS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|