C16H17BrO3S — CID 139559699
butyl 4-(5-bromo-1-benzothiophen-2-yl)-4-oxobutanoate (PubChem CID 139559699) has the molecular formula C16H17BrO3S and a molecular weight of 369.28 g/mol. Its IUPAC name is butyl 4-(5-bromo-1-benzothiophen-2-yl)-4-oxobutanoate.
| Compound Name | butyl 4-(5-bromo-1-benzothiophen-2-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 139559699 |
| Molecular Formula | C16H17BrO3S |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | butyl 4-(5-bromo-1-benzothiophen-2-yl)-4-oxobutanoate |
| SMILES | CCCCOC(=O)CCC(=O)c1cc2cc(Br)ccc2s1 |
| InChI | InChI=1S/C16H17BrO3S/c1-2-3-8-20-16(19)7-5-13(18)15-10-11-9-12(17)4-6-14(11)21-15/h4,6,9-10H,2-3,5,7-8H2,1H3 |
| InChIKey | PUGIVRCWDITAQU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|