C13H14BrNO3S — CID 4191622
butyl 2-(6-bromo-2-oxo-1,3-benzothiazol-3-yl)acetate (PubChem CID 4191622) has the molecular formula C13H14BrNO3S and a molecular weight of 344.23 g/mol. Its IUPAC name is butyl 2-(6-bromo-2-oxo-1,3-benzothiazol-3-yl)acetate.
| Compound Name | butyl 2-(6-bromo-2-oxo-1,3-benzothiazol-3-yl)acetate |
|---|---|
| PubChem CID | 4191622 |
| Molecular Formula | C13H14BrNO3S |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | butyl 2-(6-bromo-2-oxo-1,3-benzothiazol-3-yl)acetate |
| SMILES | CCCCOC(=O)Cn1c(=O)sc2cc(Br)ccc21 |
| InChI | InChI=1S/C13H14BrNO3S/c1-2-3-6-18-12(16)8-15-10-5-4-9(14)7-11(10)19-13(15)17/h4-5,7H,2-3,6,8H2,1H3 |
| InChIKey | ZSZLTMMAJRMLHR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|