C10H10N2O2S — CID 59473847
2-(6-methyl-2-oxo-1,3-benzothiazol-3-yl)acetamide (PubChem CID 59473847) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is 2-(6-methyl-2-oxo-1,3-benzothiazol-3-yl)acetamide.
| Compound Name | 2-(6-methyl-2-oxo-1,3-benzothiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 59473847 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 2-(6-methyl-2-oxo-1,3-benzothiazol-3-yl)acetamide |
| SMILES | Cc1ccc2c(c1)sc(=O)n2CC(N)=O |
| InChI | InChI=1S/C10H10N2O2S/c1-6-2-3-7-8(4-6)15-10(14)12(7)5-9(11)13/h2-4H,5H2,1H3,(H2,11,13) |
| InChIKey | UONOCPLMQYPIJD-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |