C17H15NO3S — CID 3371314
(3,5-dimethylphenyl) 2-(2-oxo-1,3-benzothiazol-3-yl)acetate (PubChem CID 3371314) has the molecular formula C17H15NO3S and a molecular weight of 313.38 g/mol. Its IUPAC name is (3,5-dimethylphenyl) 2-(2-oxo-1,3-benzothiazol-3-yl)acetate.
| Compound Name | (3,5-dimethylphenyl) 2-(2-oxo-1,3-benzothiazol-3-yl)acetate |
|---|---|
| PubChem CID | 3371314 |
| Molecular Formula | C17H15NO3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | (3,5-dimethylphenyl) 2-(2-oxo-1,3-benzothiazol-3-yl)acetate |
| SMILES | Cc1cc(C)cc(OC(=O)Cn2c(=O)sc3ccccc32)c1 |
| InChI | InChI=1S/C17H15NO3S/c1-11-7-12(2)9-13(8-11)21-16(19)10-18-14-5-3-4-6-15(14)22-17(18)20/h3-9H,10H2,1-2H3 |
| InChIKey | PISODESKJOXOFB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|