C11H8F3NOS — CID 90142340
N-methyl-5-(trifluoromethyl)-1-benzothiophene-2-carboxamide (PubChem CID 90142340) has the molecular formula C11H8F3NOS and a molecular weight of 259.25 g/mol. Its IUPAC name is N-methyl-5-(trifluoromethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-methyl-5-(trifluoromethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 90142340 |
| Molecular Formula | C11H8F3NOS |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | N-methyl-5-(trifluoromethyl)-1-benzothiophene-2-carboxamide |
| SMILES | CNC(=O)c1cc2cc(C(F)(F)F)ccc2s1 |
| InChI | InChI=1S/C11H8F3NOS/c1-15-10(16)9-5-6-4-7(11(12,13)14)2-3-8(6)17-9/h2-5H,1H3,(H,15,16) |
| InChIKey | ILAPHSUDUSGKPV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |