C24H36F2NO10PS — CID 169170745
[[difluoro-[2-(methylcarbamoyl)-1-benzothiophen-5-yl]methyl]-(methoxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate;ethane;propan-2-yl formate (PubChem CID 169170745) has the molecular formula C24H36F2NO10PS and a molecular weight of 599.59 g/mol. Its IUPAC name is [[difluoro-[2-(methylcarbamoyl)-1-benzothiophen-5-yl]methyl]-(methoxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate;ethane;propan-2-yl formate.
| Compound Name | [[difluoro-[2-(methylcarbamoyl)-1-benzothiophen-5-yl]methyl]-(methoxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate;ethane;propan-2-yl formate |
|---|---|
| PubChem CID | 169170745 |
| Molecular Formula | C24H36F2NO10PS |
| Molecular Weight | 599.59 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | [[difluoro-[2-(methylcarbamoyl)-1-benzothiophen-5-yl]methyl]-(methoxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate;ethane;propan-2-yl formate |
| SMILES | CC.CC(C)OC=O.CNC(=O)c1cc2cc(C(F)(F)P(=O)(OCOC)OCOC(=O)OC(C)C)ccc2s1 |
| InChI | InChI=1S/C18H22F2NO8PS.C4H8O2.C2H6/c1-11(2)29-17(23)26-10-28-30(24,27-9-25-4)18(19,20)13-5-6-14-12(7-13)8-15(31-14)16(22)21-3;1-4(2)6-3-5;1-2/h5-8,11H,9-10H2,1-4H3,(H,21,22);3-4H,1-2H3;1-2H3 |
| InChIKey | NIBAYWZBBZRGHM-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.59 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|