C22H27F2O9PS — CID 169218997
5-[bis(4-ethoxy-4-oxobutoxy)phosphoryl-difluoromethyl]-1-benzothiophene-2-carboxylic acid (PubChem CID 169218997) has the molecular formula C22H27F2O9PS and a molecular weight of 536.49 g/mol. Its IUPAC name is 5-[bis(4-ethoxy-4-oxobutoxy)phosphoryl-difluoromethyl]-1-benzothiophene-2-carboxylic acid.
| Compound Name | 5-[bis(4-ethoxy-4-oxobutoxy)phosphoryl-difluoromethyl]-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 169218997 |
| Molecular Formula | C22H27F2O9PS |
| Molecular Weight | 536.49 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | 5-[bis(4-ethoxy-4-oxobutoxy)phosphoryl-difluoromethyl]-1-benzothiophene-2-carboxylic acid |
| SMILES | CCOC(=O)CCCOP(=O)(OCCCC(=O)OCC)C(F)(F)c1ccc2sc(C(=O)O)cc2c1 |
| InChI | InChI=1S/C22H27F2O9PS/c1-3-30-19(25)7-5-11-32-34(29,33-12-6-8-20(26)31-4-2)22(23,24)16-9-10-17-15(13-16)14-18(35-17)21(27)28/h9-10,13-14H,3-8,11-12H2,1-2H3,(H,27,28) |
| InChIKey | NWGNTGQNFALAPU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|