C16H7F7O5PS+ — CID 169170938
[[difluoro-[2-(2,3,4,5,6-pentafluorophenoxy)carbonyl-1-benzothiophen-5-yl]methyl]-hydroxyphosphoryl]oxidanium (PubChem CID 169170938) has the molecular formula C16H7F7O5PS+ and a molecular weight of 475.25 g/mol. Its IUPAC name is [[difluoro-[2-(2,3,4,5,6-pentafluorophenoxy)carbonyl-1-benzothiophen-5-yl]methyl]-hydroxyphosphoryl]oxidanium.
| Compound Name | [[difluoro-[2-(2,3,4,5,6-pentafluorophenoxy)carbonyl-1-benzothiophen-5-yl]methyl]-hydroxyphosphoryl]oxidanium |
|---|---|
| PubChem CID | 169170938 |
| Molecular Formula | C16H7F7O5PS+ |
| Molecular Weight | 475.25 g/mol |
| Exact Mass | 474.96 |
| IUPAC Name | [[difluoro-[2-(2,3,4,5,6-pentafluorophenoxy)carbonyl-1-benzothiophen-5-yl]methyl]-hydroxyphosphoryl]oxidanium |
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)c1cc2cc(C(F)(F)P(=O)(O)[OH2+])ccc2s1 |
| InChI | InChI=1S/C16H6F7O5PS/c17-9-10(18)12(20)14(13(21)11(9)19)28-15(24)8-4-5-3-6(1-2-7(5)30-8)16(22,23)29(25,26)27/h1-4H,(H2,25,26,27)/p+1 |
| InChIKey | ZJTKQQOJYLJUMF-UHFFFAOYSA-O |
| XLogP | 4.78 |
| TPSA | 86.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.25 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|