C27H30F2NO7PS2 — CID 169218934
5-[difluoro-[2-(3-methylbutanoylsulfanyl)ethoxy-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]phosphoryl]methyl]-1-benzothiophene-2-carboxylic acid (PubChem CID 169218934) has the molecular formula C27H30F2NO7PS2 and a molecular weight of 613.64 g/mol. Its IUPAC name is 5-[difluoro-[2-(3-methylbutanoylsulfanyl)ethoxy-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]phosphoryl]methyl]-1-benzothiophene-2-carboxylic acid.
| Compound Name | 5-[difluoro-[2-(3-methylbutanoylsulfanyl)ethoxy-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]phosphoryl]methyl]-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 169218934 |
| Molecular Formula | C27H30F2NO7PS2 |
| Molecular Weight | 613.64 g/mol |
| Exact Mass | 613.12 |
| IUPAC Name | 5-[difluoro-[2-(3-methylbutanoylsulfanyl)ethoxy-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]phosphoryl]methyl]-1-benzothiophene-2-carboxylic acid |
| SMILES | CC(C)CC(=O)SCCOP(=O)(N[C@@H](C)C(=O)OCc1ccccc1)C(F)(F)c1ccc2sc(C(=O)O)cc2c1 |
| InChI | InChI=1S/C27H30F2NO7PS2/c1-17(2)13-24(31)39-12-11-37-38(35,30-18(3)26(34)36-16-19-7-5-4-6-8-19)27(28,29)21-9-10-22-20(14-21)15-23(40-22)25(32)33/h4-10,14-15,17-18H,11-13,16H2,1-3H3,(H,30,35)(H,32,33)/t18-,38?/m0/s1 |
| InChIKey | IMWUOBAZQPPBRS-GXWMPHIDSA-N |
| XLogP | 6.89 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.64 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|