C27H22ClF3NO5P — CID 146655073
benzyl (2S)-2-[[[4-chloro-2-(trifluoromethyl)phenoxy]-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 146655073) has the molecular formula C27H22ClF3NO5P and a molecular weight of 563.90 g/mol. Its IUPAC name is benzyl (2S)-2-[[[4-chloro-2-(trifluoromethyl)phenoxy]-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[4-chloro-2-(trifluoromethyl)phenoxy]-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 146655073 |
| Molecular Formula | C27H22ClF3NO5P |
| Molecular Weight | 563.90 g/mol |
| Exact Mass | 563.09 |
| IUPAC Name | benzyl (2S)-2-[[[4-chloro-2-(trifluoromethyl)phenoxy]-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(Oc1ccc(Cl)cc1C(F)(F)F)Oc1cccc2ccccc12)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H22ClF3NO5P/c1-18(26(33)35-17-19-8-3-2-4-9-19)32-38(34,36-24-13-7-11-20-10-5-6-12-22(20)24)37-25-15-14-21(28)16-23(25)27(29,30)31/h2-16,18H,17H2,1H3,(H,32,34)/t18-,38?/m0/s1 |
| InChIKey | HOVDCWCEGMXRJW-GXWMPHIDSA-N |
| XLogP | 7.80 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.90 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|