C21H20ClO4P — CID 76786008
benzyl 3-[chloro(naphthalen-1-yloxy)phosphoryl]-2-methylpropanoate (PubChem CID 76786008) has the molecular formula C21H20ClO4P and a molecular weight of 402.81 g/mol. Its IUPAC name is benzyl 3-[chloro(naphthalen-1-yloxy)phosphoryl]-2-methylpropanoate.
| Compound Name | benzyl 3-[chloro(naphthalen-1-yloxy)phosphoryl]-2-methylpropanoate |
|---|---|
| PubChem CID | 76786008 |
| Molecular Formula | C21H20ClO4P |
| Molecular Weight | 402.81 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | benzyl 3-[chloro(naphthalen-1-yloxy)phosphoryl]-2-methylpropanoate |
| SMILES | CC(CP(=O)(Cl)Oc1cccc2ccccc12)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H20ClO4P/c1-16(21(23)25-14-17-8-3-2-4-9-17)15-27(22,24)26-20-13-7-11-18-10-5-6-12-19(18)20/h2-13,16H,14-15H2,1H3 |
| InChIKey | QXMITIUENNXCCR-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.81 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|