C11H14ClO4P — CID 58475101
methyl (2S)-3-[chloro(phenoxy)phosphoryl]-2-methylpropanoate (PubChem CID 58475101) has the molecular formula C11H14ClO4P and a molecular weight of 276.66 g/mol. Its IUPAC name is methyl (2S)-3-[chloro(phenoxy)phosphoryl]-2-methylpropanoate.
| Compound Name | methyl (2S)-3-[chloro(phenoxy)phosphoryl]-2-methylpropanoate |
|---|---|
| PubChem CID | 58475101 |
| Molecular Formula | C11H14ClO4P |
| Molecular Weight | 276.66 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | methyl (2S)-3-[chloro(phenoxy)phosphoryl]-2-methylpropanoate |
| SMILES | COC(=O)[C@H](C)CP(=O)(Cl)Oc1ccccc1 |
| InChI | InChI=1S/C11H14ClO4P/c1-9(11(13)15-2)8-17(12,14)16-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3/t9-,17?/m1/s1 |
| InChIKey | OTFGNBKAJUAHEQ-SUSUGVNDSA-N |
| XLogP | 3.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.66 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|