C16H17ClNO5P — CID 20598719
[chloro(phenoxy)phosphoryl] (2S)-2-(methoxyamino)-3-phenylpropanoate (PubChem CID 20598719) has the molecular formula C16H17ClNO5P and a molecular weight of 369.74 g/mol. Its IUPAC name is [chloro(phenoxy)phosphoryl] (2S)-2-(methoxyamino)-3-phenylpropanoate.
| Compound Name | [chloro(phenoxy)phosphoryl] (2S)-2-(methoxyamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 20598719 |
| Molecular Formula | C16H17ClNO5P |
| Molecular Weight | 369.74 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | [chloro(phenoxy)phosphoryl] (2S)-2-(methoxyamino)-3-phenylpropanoate |
| SMILES | CON[C@@H](Cc1ccccc1)C(=O)OP(=O)(Cl)Oc1ccccc1 |
| InChI | InChI=1S/C16H17ClNO5P/c1-21-18-15(12-13-8-4-2-5-9-13)16(19)23-24(17,20)22-14-10-6-3-7-11-14/h2-11,15,18H,12H2,1H3/t15-,24?/m0/s1 |
| InChIKey | SVPMTJUHITUNDV-FZADBTJQSA-N |
| XLogP | 3.72 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.74 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|