C18H20N3O5P — CID 90761750
[amino(phenoxy)phosphoryl] (2S)-3-(1H-indol-3-yl)-2-(methoxyamino)propanoate (PubChem CID 90761750) has the molecular formula C18H20N3O5P and a molecular weight of 389.35 g/mol. Its IUPAC name is [amino(phenoxy)phosphoryl] (2S)-3-(1H-indol-3-yl)-2-(methoxyamino)propanoate.
| Compound Name | [amino(phenoxy)phosphoryl] (2S)-3-(1H-indol-3-yl)-2-(methoxyamino)propanoate |
|---|---|
| PubChem CID | 90761750 |
| Molecular Formula | C18H20N3O5P |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | [amino(phenoxy)phosphoryl] (2S)-3-(1H-indol-3-yl)-2-(methoxyamino)propanoate |
| SMILES | CON[C@@H](Cc1c[nH]c2ccccc12)C(=O)OP(N)(=O)Oc1ccccc1 |
| InChI | InChI=1S/C18H20N3O5P/c1-24-21-17(11-13-12-20-16-10-6-5-9-15(13)16)18(22)26-27(19,23)25-14-7-3-2-4-8-14/h2-10,12,17,20-21H,11H2,1H3,(H2,19,23)/t17-,27?/m0/s1 |
| InChIKey | DUBWLMAUDWKKJF-OIGLVOGNSA-N |
| XLogP | 2.92 |
| TPSA | 115.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|