C18H20N2O6 — CID 143838620
5-[1-hydroxy-3-(1H-indol-3-yl)-2-(methoxyamino)propylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 143838620) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is 5-[1-hydroxy-3-(1H-indol-3-yl)-2-(methoxyamino)propylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[1-hydroxy-3-(1H-indol-3-yl)-2-(methoxyamino)propylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 143838620 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 5-[1-hydroxy-3-(1H-indol-3-yl)-2-(methoxyamino)propylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CONC(Cc1c[nH]c2ccccc12)C(O)=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C18H20N2O6/c1-18(2)25-16(22)14(17(23)26-18)15(21)13(20-24-3)8-10-9-19-12-7-5-4-6-11(10)12/h4-7,9,13,19-21H,8H2,1-3H3 |
| InChIKey | UNRZUZOIQOFVEY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|