C15H18N2O4 — CID 123578433
3-(1H-indol-3-yl)-2-[(3-methoxy-3-oxopropyl)amino]propanoic acid (PubChem CID 123578433) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-2-[(3-methoxy-3-oxopropyl)amino]propanoic acid.
| Compound Name | 3-(1H-indol-3-yl)-2-[(3-methoxy-3-oxopropyl)amino]propanoic acid |
|---|---|
| PubChem CID | 123578433 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 3-(1H-indol-3-yl)-2-[(3-methoxy-3-oxopropyl)amino]propanoic acid |
| SMILES | COC(=O)CCNC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C15H18N2O4/c1-21-14(18)6-7-16-13(15(19)20)8-10-9-17-12-5-3-2-4-11(10)12/h2-5,9,13,16-17H,6-8H2,1H3,(H,19,20) |
| InChIKey | AXXVBPQCXOHMCR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |