C14H18N2O4 — CID 23088944
2-(2,3-dihydroxypropylamino)-3-(1H-indol-3-yl)propanoic acid (PubChem CID 23088944) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylamino)-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-(2,3-dihydroxypropylamino)-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 23088944 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-(2,3-dihydroxypropylamino)-3-(1H-indol-3-yl)propanoic acid |
| SMILES | O=C(O)C(Cc1c[nH]c2ccccc12)NCC(O)CO |
| InChI | InChI=1S/C14H18N2O4/c17-8-10(18)7-16-13(14(19)20)5-9-6-15-12-4-2-1-3-11(9)12/h1-4,6,10,13,15-18H,5,7-8H2,(H,19,20) |
| InChIKey | HUXPUZQSNCGISY-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |