C14H16N2O3 — CID 153333033
(2S)-3-(1H-indol-3-yl)-2-(oxiran-2-ylmethylamino)propanoic acid (PubChem CID 153333033) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is (2S)-3-(1H-indol-3-yl)-2-(oxiran-2-ylmethylamino)propanoic acid.
| Compound Name | (2S)-3-(1H-indol-3-yl)-2-(oxiran-2-ylmethylamino)propanoic acid |
|---|---|
| PubChem CID | 153333033 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (2S)-3-(1H-indol-3-yl)-2-(oxiran-2-ylmethylamino)propanoic acid |
| SMILES | O=C(O)[C@H](Cc1c[nH]c2ccccc12)NCC1CO1 |
| InChI | InChI=1S/C14H16N2O3/c17-14(18)13(16-7-10-8-19-10)5-9-6-15-12-4-2-1-3-11(9)12/h1-4,6,10,13,15-16H,5,7-8H2,(H,17,18)/t10?,13-/m0/s1 |
| InChIKey | DGHNQQPVWRRSHZ-HQVZTVAUSA-N |
| XLogP | 1.15 |
| TPSA | 77.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|