C19H20N2O4S — CID 139660536
2-[2-(benzenesulfonyl)ethylamino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 139660536) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)ethylamino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[2-(benzenesulfonyl)ethylamino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 139660536 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2-[2-(benzenesulfonyl)ethylamino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | O=C(O)C(Cc1c[nH]c2ccccc12)NCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O4S/c22-19(23)18(12-14-13-21-17-9-5-4-8-16(14)17)20-10-11-26(24,25)15-6-2-1-3-7-15/h1-9,13,18,20-21H,10-12H2,(H,22,23) |
| InChIKey | FDGJBKUTMFJFHA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |