C18H18ClN2O4P — CID 11994047
methyl (2R)-2-[[chloro(phenoxy)phosphoryl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 11994047) has the molecular formula C18H18ClN2O4P and a molecular weight of 392.78 g/mol. Its IUPAC name is methyl (2R)-2-[[chloro(phenoxy)phosphoryl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl (2R)-2-[[chloro(phenoxy)phosphoryl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 11994047 |
| Molecular Formula | C18H18ClN2O4P |
| Molecular Weight | 392.78 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | methyl (2R)-2-[[chloro(phenoxy)phosphoryl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | COC(=O)[C@@H](Cc1c[nH]c2ccccc12)NP(=O)(Cl)Oc1ccccc1 |
| InChI | InChI=1S/C18H18ClN2O4P/c1-24-18(22)17(11-13-12-20-16-10-6-5-9-15(13)16)21-26(19,23)25-14-7-3-2-4-8-14/h2-10,12,17,20H,11H2,1H3,(H,21,23)/t17-,26?/m1/s1 |
| InChIKey | QYATWIXXPCXYNA-SIHBAMTISA-N |
| XLogP | 4.27 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.78 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|