C19H29N2O5P — CID 122215678
methyl (2S)-2-[di(propan-2-yloxy)phosphorylmethylamino]-3-(1H-indol-3-yl)propanoate (PubChem CID 122215678) has the molecular formula C19H29N2O5P and a molecular weight of 396.42 g/mol. Its IUPAC name is methyl (2S)-2-[di(propan-2-yloxy)phosphorylmethylamino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl (2S)-2-[di(propan-2-yloxy)phosphorylmethylamino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 122215678 |
| Molecular Formula | C19H29N2O5P |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | methyl (2S)-2-[di(propan-2-yloxy)phosphorylmethylamino]-3-(1H-indol-3-yl)propanoate |
| SMILES | COC(=O)[C@H](Cc1c[nH]c2ccccc12)NCP(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C19H29N2O5P/c1-13(2)25-27(23,26-14(3)4)12-21-18(19(22)24-5)10-15-11-20-17-9-7-6-8-16(15)17/h6-9,11,13-14,18,20-21H,10,12H2,1-5H3/t18-/m0/s1 |
| InChIKey | KJDFPVPKHHFUSN-SFHVURJKSA-N |
| XLogP | 3.84 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|