C19H13F5NO5P — CID 138491690
(2S)-2-[[naphthalen-1-yloxy-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoic acid (PubChem CID 138491690) has the molecular formula C19H13F5NO5P and a molecular weight of 461.28 g/mol. Its IUPAC name is (2S)-2-[[naphthalen-1-yloxy-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoic acid.
| Compound Name | (2S)-2-[[naphthalen-1-yloxy-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 138491690 |
| Molecular Formula | C19H13F5NO5P |
| Molecular Weight | 461.28 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | (2S)-2-[[naphthalen-1-yloxy-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoic acid |
| SMILES | C[C@H](N[P@](=O)(Oc1c(F)c(F)c(F)c(F)c1F)Oc1cccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C19H13F5NO5P/c1-9(19(26)27)25-31(28,29-12-8-4-6-10-5-2-3-7-11(10)12)30-18-16(23)14(21)13(20)15(22)17(18)24/h2-9H,1H3,(H,25,28)(H,26,27)/t9-,31+/m0/s1 |
| InChIKey | ZAHBNISHUFTFTB-UQARLRAFSA-N |
| XLogP | 5.16 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.28 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|