C21H26F2NO4P — CID 169219218
benzyl (2S)-2-[[1,1-difluoroethyl(phenoxy)phosphoryl]amino]-4-methylpentanoate (PubChem CID 169219218) has the molecular formula C21H26F2NO4P and a molecular weight of 425.41 g/mol. Its IUPAC name is benzyl (2S)-2-[[1,1-difluoroethyl(phenoxy)phosphoryl]amino]-4-methylpentanoate.
| Compound Name | benzyl (2S)-2-[[1,1-difluoroethyl(phenoxy)phosphoryl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 169219218 |
| Molecular Formula | C21H26F2NO4P |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | benzyl (2S)-2-[[1,1-difluoroethyl(phenoxy)phosphoryl]amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NP(=O)(Oc1ccccc1)C(C)(F)F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H26F2NO4P/c1-16(2)14-19(20(25)27-15-17-10-6-4-7-11-17)24-29(26,21(3,22)23)28-18-12-8-5-9-13-18/h4-13,16,19H,14-15H2,1-3H3,(H,24,26)/t19-,29?/m0/s1 |
| InChIKey | GHELAHBCFNFFQM-KCHZNAQISA-N |
| XLogP | 5.62 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|