C24H28F3NO7S — CID 87903407
benzyl (2S)-2-[[(2S)-1-methoxy-1-oxo-3-[3-(trifluoromethylsulfonyloxy)phenyl]propan-2-yl]amino]-4-methylpentanoate (PubChem CID 87903407) has the molecular formula C24H28F3NO7S and a molecular weight of 531.55 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S)-1-methoxy-1-oxo-3-[3-(trifluoromethylsulfonyloxy)phenyl]propan-2-yl]amino]-4-methylpentanoate.
| Compound Name | benzyl (2S)-2-[[(2S)-1-methoxy-1-oxo-3-[3-(trifluoromethylsulfonyloxy)phenyl]propan-2-yl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 87903407 |
| Molecular Formula | C24H28F3NO7S |
| Molecular Weight | 531.55 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | benzyl (2S)-2-[[(2S)-1-methoxy-1-oxo-3-[3-(trifluoromethylsulfonyloxy)phenyl]propan-2-yl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](Cc1cccc(OS(=O)(=O)C(F)(F)F)c1)N[C@@H](CC(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H28F3NO7S/c1-16(2)12-20(23(30)34-15-17-8-5-4-6-9-17)28-21(22(29)33-3)14-18-10-7-11-19(13-18)35-36(31,32)24(25,26)27/h4-11,13,16,20-21,28H,12,14-15H2,1-3H3/t20-,21-/m0/s1 |
| InChIKey | SSQJSWMXRSJIOU-SFTDATJTSA-N |
| XLogP | 3.75 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|