C25H32F3NO6S — CID 90708814
benzyl (2S)-4-methyl-2-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]pentanoate;methyl trifluoromethanesulfonate (PubChem CID 90708814) has the molecular formula C25H32F3NO6S and a molecular weight of 531.59 g/mol. Its IUPAC name is benzyl (2S)-4-methyl-2-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]pentanoate;methyl trifluoromethanesulfonate.
| Compound Name | benzyl (2S)-4-methyl-2-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]pentanoate;methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 90708814 |
| Molecular Formula | C25H32F3NO6S |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | benzyl (2S)-4-methyl-2-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]pentanoate;methyl trifluoromethanesulfonate |
| SMILES | CC(=O)[C@H](Cc1ccccc1)N[C@@H](CC(C)C)C(=O)OCc1ccccc1.COS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C23H29NO3.C2H3F3O3S/c1-17(2)14-22(23(26)27-16-20-12-8-5-9-13-20)24-21(18(3)25)15-19-10-6-4-7-11-19;1-8-9(6,7)2(3,4)5/h4-13,17,21-22,24H,14-16H2,1-3H3;1H3/t21-,22-;/m0./s1 |
| InChIKey | CFMBLAFJNLSNQW-VROPFNGYSA-N |
| XLogP | 4.42 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|