C14H17F3O4S — CID 22851309
benzyl (2R)-4-methyl-2-(trifluoromethylsulfonyl)pentanoate (PubChem CID 22851309) has the molecular formula C14H17F3O4S and a molecular weight of 338.35 g/mol. Its IUPAC name is benzyl (2R)-4-methyl-2-(trifluoromethylsulfonyl)pentanoate.
| Compound Name | benzyl (2R)-4-methyl-2-(trifluoromethylsulfonyl)pentanoate |
|---|---|
| PubChem CID | 22851309 |
| Molecular Formula | C14H17F3O4S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | benzyl (2R)-4-methyl-2-(trifluoromethylsulfonyl)pentanoate |
| SMILES | CC(C)C[C@H](C(=O)OCc1ccccc1)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H17F3O4S/c1-10(2)8-12(22(19,20)14(15,16)17)13(18)21-9-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3/t12-/m1/s1 |
| InChIKey | SFYNUQGSXWVHDT-GFCCVEGCSA-N |
| XLogP | 3.08 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |