C12H13F3O5S — CID 87077899
benzyl 2-(2,2,2-trifluoroethylsulfonyloxy)propanoate (PubChem CID 87077899) has the molecular formula C12H13F3O5S and a molecular weight of 326.29 g/mol. Its IUPAC name is benzyl 2-(2,2,2-trifluoroethylsulfonyloxy)propanoate.
| Compound Name | benzyl 2-(2,2,2-trifluoroethylsulfonyloxy)propanoate |
|---|---|
| PubChem CID | 87077899 |
| Molecular Formula | C12H13F3O5S |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | benzyl 2-(2,2,2-trifluoroethylsulfonyloxy)propanoate |
| SMILES | CC(OS(=O)(=O)CC(F)(F)F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C12H13F3O5S/c1-9(20-21(17,18)8-12(13,14)15)11(16)19-7-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3 |
| InChIKey | FUYNGVIWFAKWCF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|