C17H15F3O5S — CID 174385767
benzyl (2R,3R)-3-hydroxy-3-phenyl-2-(trifluoromethylsulfonyl)propanoate (PubChem CID 174385767) has the molecular formula C17H15F3O5S and a molecular weight of 388.36 g/mol. Its IUPAC name is benzyl (2R,3R)-3-hydroxy-3-phenyl-2-(trifluoromethylsulfonyl)propanoate.
| Compound Name | benzyl (2R,3R)-3-hydroxy-3-phenyl-2-(trifluoromethylsulfonyl)propanoate |
|---|---|
| PubChem CID | 174385767 |
| Molecular Formula | C17H15F3O5S |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | benzyl (2R,3R)-3-hydroxy-3-phenyl-2-(trifluoromethylsulfonyl)propanoate |
| SMILES | O=C(OCc1ccccc1)[C@@H]([C@H](O)c1ccccc1)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C17H15F3O5S/c18-17(19,20)26(23,24)15(14(21)13-9-5-2-6-10-13)16(22)25-11-12-7-3-1-4-8-12/h1-10,14-15,21H,11H2/t14-,15-/m1/s1 |
| InChIKey | VXOLTTJWDVMJDF-HUUCEWRRSA-N |
| XLogP | 2.77 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |