C14H17F3O2S — CID 162538823
benzyl 4-methyl-2-(trifluoromethylsulfanyl)pentanoate (PubChem CID 162538823) has the molecular formula C14H17F3O2S and a molecular weight of 306.35 g/mol. Its IUPAC name is benzyl 4-methyl-2-(trifluoromethylsulfanyl)pentanoate.
| Compound Name | benzyl 4-methyl-2-(trifluoromethylsulfanyl)pentanoate |
|---|---|
| PubChem CID | 162538823 |
| Molecular Formula | C14H17F3O2S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | benzyl 4-methyl-2-(trifluoromethylsulfanyl)pentanoate |
| SMILES | CC(C)CC(SC(F)(F)F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H17F3O2S/c1-10(2)8-12(20-14(15,16)17)13(18)19-9-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3 |
| InChIKey | OKUTWLQBZUDMTN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |