C26H24FN2O5PS — CID 178108735
benzyl (2S)-2-[[[(R)-(2-carbamoyl-1-benzothiophen-5-yl)-fluoromethyl]-phenoxyphosphoryl]amino]propanoate (PubChem CID 178108735) has the molecular formula C26H24FN2O5PS and a molecular weight of 526.53 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(R)-(2-carbamoyl-1-benzothiophen-5-yl)-fluoromethyl]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(R)-(2-carbamoyl-1-benzothiophen-5-yl)-fluoromethyl]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 178108735 |
| Molecular Formula | C26H24FN2O5PS |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | benzyl (2S)-2-[[[(R)-(2-carbamoyl-1-benzothiophen-5-yl)-fluoromethyl]-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(Oc1ccccc1)[C@@H](F)c1ccc2sc(C(N)=O)cc2c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H24FN2O5PS/c1-17(26(31)33-16-18-8-4-2-5-9-18)29-35(32,34-21-10-6-3-7-11-21)24(27)19-12-13-22-20(14-19)15-23(36-22)25(28)30/h2-15,17,24H,16H2,1H3,(H2,28,30)(H,29,32)/t17-,24+,35?/m0/s1 |
| InChIKey | PWVXXSMASSQACK-YJEHTYKISA-N |
| XLogP | 5.96 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|