C17H24F2NO3PS — CID 156858510
[difluoro-[2-(methylcarbamoyl)-1-benzothiophen-5-yl]methyl]phosphonous acid;hexane (PubChem CID 156858510) has the molecular formula C17H24F2NO3PS and a molecular weight of 391.42 g/mol. Its IUPAC name is [difluoro-[2-(methylcarbamoyl)-1-benzothiophen-5-yl]methyl]phosphonous acid;hexane.
| Compound Name | [difluoro-[2-(methylcarbamoyl)-1-benzothiophen-5-yl]methyl]phosphonous acid;hexane |
|---|---|
| PubChem CID | 156858510 |
| Molecular Formula | C17H24F2NO3PS |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | [difluoro-[2-(methylcarbamoyl)-1-benzothiophen-5-yl]methyl]phosphonous acid;hexane |
| SMILES | CCCCCC.CNC(=O)c1cc2cc(C(F)(F)P(O)O)ccc2s1 |
| InChI | InChI=1S/C11H10F2NO3PS.C6H14/c1-14-10(15)9-5-6-4-7(2-3-8(6)19-9)11(12,13)18(16)17;1-3-5-6-4-2/h2-5,16-17H,1H3,(H,14,15);3-6H2,1-2H3 |
| InChIKey | WABDSMSIUQYUAI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|