C16H9F4N3O3S — CID 55439102
5-fluoro-N'-[2-nitro-4-(trifluoromethyl)phenyl]-1-benzothiophene-2-carbohydrazide (PubChem CID 55439102) has the molecular formula C16H9F4N3O3S and a molecular weight of 399.33 g/mol. Its IUPAC name is 5-fluoro-N'-[2-nitro-4-(trifluoromethyl)phenyl]-1-benzothiophene-2-carbohydrazide.
| Compound Name | 5-fluoro-N'-[2-nitro-4-(trifluoromethyl)phenyl]-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 55439102 |
| Molecular Formula | C16H9F4N3O3S |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 5-fluoro-N'-[2-nitro-4-(trifluoromethyl)phenyl]-1-benzothiophene-2-carbohydrazide |
| SMILES | O=C(NNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1cc2cc(F)ccc2s1 |
| InChI | InChI=1S/C16H9F4N3O3S/c17-10-2-4-13-8(5-10)6-14(27-13)15(24)22-21-11-3-1-9(16(18,19)20)7-12(11)23(25)26/h1-7,21H,(H,22,24) |
| InChIKey | FZRHAKILPXOSFR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|