C14H14BrNO4S — CID 131984085
methyl 5-[(2-bromo-2-methylpropanoyl)amino]-6-hydroxy-1-benzothiophene-2-carboxylate (PubChem CID 131984085) has the molecular formula C14H14BrNO4S and a molecular weight of 372.24 g/mol. Its IUPAC name is methyl 5-[(2-bromo-2-methylpropanoyl)amino]-6-hydroxy-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 5-[(2-bromo-2-methylpropanoyl)amino]-6-hydroxy-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 131984085 |
| Molecular Formula | C14H14BrNO4S |
| Molecular Weight | 372.24 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | methyl 5-[(2-bromo-2-methylpropanoyl)amino]-6-hydroxy-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1cc2cc(NC(=O)C(C)(C)Br)c(O)cc2s1 |
| InChI | InChI=1S/C14H14BrNO4S/c1-14(2,15)13(19)16-8-4-7-5-11(12(18)20-3)21-10(7)6-9(8)17/h4-6,17H,1-3H3,(H,16,19) |
| InChIKey | RYOHSPUXJWMRHU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.24 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|